C16H24BN5OS — CID 137328777
[3-[(1H-benzimidazol-2-ylcarbamothioylamino)methyl]-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]boranuide (PubChem CID 137328777) has the molecular formula C16H24BN5OS and a molecular weight of 345.28 g/mol. Its IUPAC name is [3-[(1H-benzimidazol-2-ylcarbamothioylamino)methyl]-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]boranuide.
| Compound Name | [3-[(1H-benzimidazol-2-ylcarbamothioylamino)methyl]-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]boranuide |
|---|---|
| PubChem CID | 137328777 |
| Molecular Formula | C16H24BN5OS |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | [3-[(1H-benzimidazol-2-ylcarbamothioylamino)methyl]-3-hydroxy-1-azoniabicyclo[2.2.2]octan-1-yl]boranuide |
| SMILES | [BH3-][N+]12CCC(CC1)C(O)(CNC(=S)Nc1nc3ccccc3[nH]1)C2 |
| InChI | InChI=1S/C16H24BN5OS/c17-22-7-5-11(6-8-22)16(23,10-22)9-18-15(24)21-14-19-12-3-1-2-4-13(12)20-14/h1-4,11,23H,5-10H2,17H3,(H3,18,19,20,21,24) |
| InChIKey | CTGFMGYWVHXZRA-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|