C12H18N2 — CID 176696462
6-[(1Z)-buta-1,3-dienyl]-5-methylpyridin-3-amine;ethane (PubChem CID 176696462) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-5-methylpyridin-3-amine;ethane.
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-5-methylpyridin-3-amine;ethane |
|---|---|
| PubChem CID | 176696462 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-5-methylpyridin-3-amine;ethane |
| SMILES | C=C/C=C\c1ncc(N)cc1C.CC |
| InChI | InChI=1S/C10H12N2.C2H6/c1-3-4-5-10-8(2)6-9(11)7-12-10;1-2/h3-7H,1,11H2,2H3;1-2H3/b5-4-; |
| InChIKey | IGVIAXDGTOADQA-MKWAYWHRSA-N |
| XLogP | 3.20 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|