C15H25N — CID 143845327
3-[(1Z)-buta-1,3-dienyl]-2,5-dimethylpyridine;ethane (PubChem CID 143845327) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2,5-dimethylpyridine;ethane.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2,5-dimethylpyridine;ethane |
|---|---|
| PubChem CID | 143845327 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2,5-dimethylpyridine;ethane |
| SMILES | C=C/C=C\c1cc(C)cnc1C.CC.CC |
| InChI | InChI=1S/C11H13N.2C2H6/c1-4-5-6-11-7-9(2)8-12-10(11)3;2*1-2/h4-8H,1H2,2-3H3;2*1-2H3/b6-5-;; |
| InChIKey | KISSTYQDVGICFS-XNOMRPDFSA-N |
| XLogP | 4.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|