C11H13N — CID 134859685
5-buta-1,3-dienyl-2,3-dimethylpyridine (PubChem CID 134859685) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 5-buta-1,3-dienyl-2,3-dimethylpyridine.
| Compound Name | 5-buta-1,3-dienyl-2,3-dimethylpyridine |
|---|---|
| PubChem CID | 134859685 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 5-buta-1,3-dienyl-2,3-dimethylpyridine |
| SMILES | C=CC=Cc1cnc(C)c(C)c1 |
| InChI | InChI=1S/C11H13N/c1-4-5-6-11-7-9(2)10(3)12-8-11/h4-8H,1H2,2-3H3 |
| InChIKey | AESGSKQCWUQHON-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|