C9H14NY- — CID 161357475
carbanide;2,3,5-trimethylpyridine;yttrium (PubChem CID 161357475) has the molecular formula C9H14NY- and a molecular weight of 225.12 g/mol. Its IUPAC name is carbanide;2,3,5-trimethylpyridine;yttrium.
| Compound Name | carbanide;2,3,5-trimethylpyridine;yttrium |
|---|---|
| PubChem CID | 161357475 |
| Molecular Formula | C9H14NY- |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | carbanide;2,3,5-trimethylpyridine;yttrium |
| SMILES | Cc1cnc(C)c(C)c1.[CH3-].[Y] |
| InChI | InChI=1S/C8H11N.CH3.Y/c1-6-4-7(2)8(3)9-5-6;;/h4-5H,1-3H3;1H3;/q;-1; |
| InChIKey | PGFZQUNLCQCOAI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|