C14H16N2Se2 — CID 175679349
2-[(3,5-dimethyl-2-pyridinyl)diselanyl]-3,5-dimethylpyridine (PubChem CID 175679349) has the molecular formula C14H16N2Se2 and a molecular weight of 370.22 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-2-pyridinyl)diselanyl]-3,5-dimethylpyridine.
| Compound Name | 2-[(3,5-dimethyl-2-pyridinyl)diselanyl]-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 175679349 |
| Molecular Formula | C14H16N2Se2 |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 2-[(3,5-dimethyl-2-pyridinyl)diselanyl]-3,5-dimethylpyridine |
| SMILES | Cc1cnc([Se][Se]c2ncc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C14H16N2Se2/c1-9-5-11(3)13(15-7-9)17-18-14-12(4)6-10(2)8-16-14/h5-8H,1-4H3 |
| InChIKey | MRJQYDSMXCWHSS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|