3,5-dimethylpyridine-2-carboxylic acid

C8H9NO2 — CID 15426890

IUPAC3,5-dimethylpyridine-2-carboxylic acid
SMILESCc1cnc(C(=O)O)c(C)c1
InChIInChI=1S/C8H9NO2/c1-5-3-6(2)7(8(10)11)9-4-5/h3-4H,1-2H3,(H,10,11)
InChIKeyCRQQOEOERUUJFO-UHFFFAOYSA-N
MW151.16 g/mol
LogP1.40
Rot. Bonds1

About 3,5-dimethylpyridine-2-carboxylic acid

3,5-dimethylpyridine-2-carboxylic acid (PubChem CID 15426890) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 3,5-dimethylpyridine-2-carboxylic acid.

Molecular Properties

Compound Name3,5-dimethylpyridine-2-carboxylic acid
PubChem CID15426890
Molecular FormulaC8H9NO2
Molecular Weight151.16 g/mol
Exact Mass151.06
IUPAC Name3,5-dimethylpyridine-2-carboxylic acid
SMILESCc1cnc(C(=O)O)c(C)c1
InChIInChI=1S/C8H9NO2/c1-5-3-6(2)7(8(10)11)9-4-5/h3-4H,1-2H3,(H,10,11)
InChIKeyCRQQOEOERUUJFO-UHFFFAOYSA-N
XLogP1.40
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.16
LogP ≤ 51.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,5-dimethylpyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethylpyridine-2-carboxylic acid?
The IUPAC name of 3,5-dimethylpyridine-2-carboxylic acid (CID 15426890) is 3,5-dimethylpyridine-2-carboxylic acid.
What is the SMILES notation for 3,5-dimethylpyridine-2-carboxylic acid?
The canonical SMILES for 3,5-dimethylpyridine-2-carboxylic acid is Cc1cnc(C(=O)O)c(C)c1.
What is the InChIKey of 3,5-dimethylpyridine-2-carboxylic acid?
The InChIKey is CRQQOEOERUUJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-5-3-6(2)7(8(10)11)9-4-5/h3-4H,1-2H3,(H,10,11).
What are the key properties of 3,5-dimethylpyridine-2-carboxylic acid?
3,5-dimethylpyridine-2-carboxylic acid has a molecular weight of 151.16 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylpyridine-2-carboxylic acid is sourced from PubChem (CID 15426890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).