C8H11N3 — CID 112703746
3,5-dimethylpyridine-2-carboximidamide (PubChem CID 112703746) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 3,5-dimethylpyridine-2-carboximidamide.
| Compound Name | 3,5-dimethylpyridine-2-carboximidamide |
|---|---|
| PubChem CID | 112703746 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 3,5-dimethylpyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncc(C)cc1C |
| InChI | InChI=1S/C8H11N3/c1-5-3-6(2)7(8(9)10)11-4-5/h3-4H,1-2H3,(H3,9,10) |
| InChIKey | JHSQQCCBBPXJFV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|