C6H6ClI2N3 — CID 133057044
3,5-diiodopyridine-2-carboximidamide;hydrochloride (PubChem CID 133057044) has the molecular formula C6H6ClI2N3 and a molecular weight of 409.40 g/mol. Its IUPAC name is 3,5-diiodopyridine-2-carboximidamide;hydrochloride.
| Compound Name | 3,5-diiodopyridine-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 133057044 |
| Molecular Formula | C6H6ClI2N3 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 408.83 |
| IUPAC Name | 3,5-diiodopyridine-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ncc(I)cc1I |
| InChI | InChI=1S/C6H5I2N3.ClH/c7-3-1-4(8)5(6(9)10)11-2-3;/h1-2H,(H3,9,10);1H |
| InChIKey | GNTLQTANGDCJLC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|