C7H11ClN4 — CID 122129858
3,6-dimethylpyrazine-2-carboximidamide;hydrochloride (PubChem CID 122129858) has the molecular formula C7H11ClN4 and a molecular weight of 186.65 g/mol. Its IUPAC name is 3,6-dimethylpyrazine-2-carboximidamide;hydrochloride.
| Compound Name | 3,6-dimethylpyrazine-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 122129858 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 3,6-dimethylpyrazine-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1nc(C)cnc1C |
| InChI | InChI=1S/C7H10N4.ClH/c1-4-3-10-5(2)6(11-4)7(8)9;/h3H,1-2H3,(H3,8,9);1H |
| InChIKey | IYORWDGDBVPJMH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|