C8H11N3 — CID 145200965
1-(3,5-dimethylpyrazin-2-yl)ethenamine (PubChem CID 145200965) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazin-2-yl)ethenamine.
| Compound Name | 1-(3,5-dimethylpyrazin-2-yl)ethenamine |
|---|---|
| PubChem CID | 145200965 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1-(3,5-dimethylpyrazin-2-yl)ethenamine |
| SMILES | C=C(N)c1ncc(C)nc1C |
| InChI | InChI=1S/C8H11N3/c1-5-4-10-8(6(2)9)7(3)11-5/h4H,2,9H2,1,3H3 |
| InChIKey | GXSUVYXLYUDHOK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |