C10H12N6 — CID 62684726
3-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboximidamide (PubChem CID 62684726) has the molecular formula C10H12N6 and a molecular weight of 216.25 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboximidamide.
| Compound Name | 3-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboximidamide |
|---|---|
| PubChem CID | 62684726 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 3-(4,5-dimethylimidazol-1-yl)pyrazine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1nccnc1-n1cnc(C)c1C |
| InChI | InChI=1S/C10H12N6/c1-6-7(2)16(5-15-6)10-8(9(11)12)13-3-4-14-10/h3-5H,1-2H3,(H3,11,12) |
| InChIKey | BEGUDJNGRKSWKC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|