C9H9N5 — CID 172623035
6-methylpyrido[2,3-d]pyrimidine-2-carboximidamide (PubChem CID 172623035) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is 6-methylpyrido[2,3-d]pyrimidine-2-carboximidamide.
| Compound Name | 6-methylpyrido[2,3-d]pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 172623035 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 6-methylpyrido[2,3-d]pyrimidine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncc2cc(C)cnc2n1 |
| InChI | InChI=1S/C9H9N5/c1-5-2-6-4-13-9(7(10)11)14-8(6)12-3-5/h2-4H,1H3,(H3,10,11) |
| InChIKey | WPFAYLUYJBVVLU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|