C14H16N4O — CID 107550824
2-(2,5-dimethylphenoxy)-6-methylpyrimidine-4-carboximidamide (PubChem CID 107550824) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107550824 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-6-methylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(Oc2cc(C)ccc2C)n1 |
| InChI | InChI=1S/C14H16N4O/c1-8-4-5-9(2)12(6-8)19-14-17-10(3)7-11(18-14)13(15)16/h4-7H,1-3H3,(H3,15,16) |
| InChIKey | QGWLLPBJEZHNQS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|