C10H16N4O2 — CID 107551032
2-(3-methoxypropoxy)-6-methylpyrimidine-4-carboximidamide (PubChem CID 107551032) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)-6-methylpyrimidine-4-carboximidamide.
| Compound Name | 2-(3-methoxypropoxy)-6-methylpyrimidine-4-carboximidamide |
|---|---|
| PubChem CID | 107551032 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-(3-methoxypropoxy)-6-methylpyrimidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(OCCCOC)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-7-6-8(9(11)12)14-10(13-7)16-5-3-4-15-2/h6H,3-5H2,1-2H3,(H3,11,12) |
| InChIKey | HDQFBCYHCVAHHL-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|