C12H15N5 — CID 164792579
7-tert-butylpyrido[3,2-d]pyrimidine-2-carboximidamide (PubChem CID 164792579) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 7-tert-butylpyrido[3,2-d]pyrimidine-2-carboximidamide.
| Compound Name | 7-tert-butylpyrido[3,2-d]pyrimidine-2-carboximidamide |
|---|---|
| PubChem CID | 164792579 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 7-tert-butylpyrido[3,2-d]pyrimidine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncc2ncc(C(C)(C)C)cc2n1 |
| InChI | InChI=1S/C12H15N5/c1-12(2,3)7-4-8-9(15-5-7)6-16-11(17-8)10(13)14/h4-6H,1-3H3,(H3,13,14) |
| InChIKey | CHIPUKMGGMTWPB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|