C16H22N2 — CID 171466000
2,7-ditert-butyl-1,5-naphthyridine (PubChem CID 171466000) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2,7-ditert-butyl-1,5-naphthyridine.
| Compound Name | 2,7-ditert-butyl-1,5-naphthyridine |
|---|---|
| PubChem CID | 171466000 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2,7-ditert-butyl-1,5-naphthyridine |
| SMILES | CC(C)(C)c1cnc2ccc(C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C16H22N2/c1-15(2,3)11-9-13-12(17-10-11)7-8-14(18-13)16(4,5)6/h7-10H,1-6H3 |
| InChIKey | KBZXOAGAUCWQQX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |