C12H13FN2 — CID 171406590
2-tert-butyl-7-fluoro-1,5-naphthyridine (PubChem CID 171406590) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-tert-butyl-7-fluoro-1,5-naphthyridine.
| Compound Name | 2-tert-butyl-7-fluoro-1,5-naphthyridine |
|---|---|
| PubChem CID | 171406590 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-tert-butyl-7-fluoro-1,5-naphthyridine |
| SMILES | CC(C)(C)c1ccc2ncc(F)cc2n1 |
| InChI | InChI=1S/C12H13FN2/c1-12(2,3)11-5-4-9-10(15-11)6-8(13)7-14-9/h4-7H,1-3H3 |
| InChIKey | BSROPMYBBJTKRH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |