C8H5F3N4 — CID 150983052
7-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 150983052) has the molecular formula C8H5F3N4 and a molecular weight of 214.15 g/mol. Its IUPAC name is 7-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 7-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 150983052 |
| Molecular Formula | C8H5F3N4 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 7-(trifluoromethyl)pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | Nc1ncc2ncc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C8H5F3N4/c9-8(10,11)4-1-5-6(13-2-4)3-14-7(12)15-5/h1-3H,(H2,12,14,15) |
| InChIKey | LQMQGKIDXZFGGH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |