C11H12NO- — CID 144589862
[2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-pyridinyl]methanolate (PubChem CID 144589862) has the molecular formula C11H12NO- and a molecular weight of 174.22 g/mol. Its IUPAC name is [2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-pyridinyl]methanolate.
| Compound Name | [2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-pyridinyl]methanolate |
|---|---|
| PubChem CID | 144589862 |
| Molecular Formula | C11H12NO- |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | [2-[(1Z)-buta-1,3-dienyl]-5-methyl-3-pyridinyl]methanolate |
| SMILES | C=C/C=C\c1ncc(C)cc1C[O-] |
| InChI | InChI=1S/C11H12NO/c1-3-4-5-11-10(8-13)6-9(2)7-12-11/h3-7H,1,8H2,2H3/q-1/b5-4- |
| InChIKey | AZPMFEKYFNFMJK-PLNGDYQASA-N |
| XLogP | 1.45 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|