C11H15NO — CID 170476275
4-(3,5-dimethyl-2-pyridinyl)but-3-en-1-ol (PubChem CID 170476275) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-(3,5-dimethyl-2-pyridinyl)but-3-en-1-ol.
| Compound Name | 4-(3,5-dimethyl-2-pyridinyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 170476275 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-(3,5-dimethyl-2-pyridinyl)but-3-en-1-ol |
| SMILES | Cc1cnc(C=CCCO)c(C)c1 |
| InChI | InChI=1S/C11H15NO/c1-9-7-10(2)11(12-8-9)5-3-4-6-13/h3,5,7-8,13H,4,6H2,1-2H3 |
| InChIKey | YQWHAHOADYGFHR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |