C10H13ClN2 — CID 170486654
4-(5-chloro-3-methyl-2-pyridinyl)but-3-en-1-amine (PubChem CID 170486654) has the molecular formula C10H13ClN2 and a molecular weight of 196.68 g/mol. Its IUPAC name is 4-(5-chloro-3-methyl-2-pyridinyl)but-3-en-1-amine.
| Compound Name | 4-(5-chloro-3-methyl-2-pyridinyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 170486654 |
| Molecular Formula | C10H13ClN2 |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-(5-chloro-3-methyl-2-pyridinyl)but-3-en-1-amine |
| SMILES | Cc1cc(Cl)cnc1C=CCCN |
| InChI | InChI=1S/C10H13ClN2/c1-8-6-9(11)7-13-10(8)4-2-3-5-12/h2,4,6-7H,3,5,12H2,1H3 |
| InChIKey | AYXUULPTQALXKE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |