C8H10ClN3O — CID 170476337
4-(5-amino-3-chloropyrazin-2-yl)but-3-en-1-ol (PubChem CID 170476337) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is 4-(5-amino-3-chloropyrazin-2-yl)but-3-en-1-ol.
| Compound Name | 4-(5-amino-3-chloropyrazin-2-yl)but-3-en-1-ol |
|---|---|
| PubChem CID | 170476337 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 4-(5-amino-3-chloropyrazin-2-yl)but-3-en-1-ol |
| SMILES | Nc1cnc(C=CCCO)c(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3O/c9-8-6(3-1-2-4-13)11-5-7(10)12-8/h1,3,5,13H,2,4H2,(H2,10,12) |
| InChIKey | GYGQTFFNUHEIFT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |