C10H13ClN4O — CID 170488447
N-[4-(5-amino-3-chloropyrazin-2-yl)but-3-enyl]acetamide (PubChem CID 170488447) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is N-[4-(5-amino-3-chloropyrazin-2-yl)but-3-enyl]acetamide.
| Compound Name | N-[4-(5-amino-3-chloropyrazin-2-yl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170488447 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | N-[4-(5-amino-3-chloropyrazin-2-yl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1ncc(N)nc1Cl |
| InChI | InChI=1S/C10H13ClN4O/c1-7(16)13-5-3-2-4-8-10(11)15-9(12)6-14-8/h2,4,6H,3,5H2,1H3,(H2,12,15)(H,13,16) |
| InChIKey | PKWQTRQLADRSGY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|