C10H12ClN3O — CID 170489699
N-[4-(6-chloropyridazin-3-yl)but-3-enyl]acetamide (PubChem CID 170489699) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is N-[4-(6-chloropyridazin-3-yl)but-3-enyl]acetamide.
| Compound Name | N-[4-(6-chloropyridazin-3-yl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489699 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | N-[4-(6-chloropyridazin-3-yl)but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1ccc(Cl)nn1 |
| InChI | InChI=1S/C10H12ClN3O/c1-8(15)12-7-3-2-4-9-5-6-10(11)14-13-9/h2,4-6H,3,7H2,1H3,(H,12,15) |
| InChIKey | YKHYNRXCXQDAMI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|