C12H17N3O3 — CID 170489028
N-[4-(2,4-dimethoxypyrimidin-5-yl)but-3-enyl]acetamide (PubChem CID 170489028) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is N-[4-(2,4-dimethoxypyrimidin-5-yl)but-3-enyl]acetamide.
| Compound Name | N-[4-(2,4-dimethoxypyrimidin-5-yl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489028 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[4-(2,4-dimethoxypyrimidin-5-yl)but-3-enyl]acetamide |
| SMILES | COc1ncc(C=CCCNC(C)=O)c(OC)n1 |
| InChI | InChI=1S/C12H17N3O3/c1-9(16)13-7-5-4-6-10-8-14-12(18-3)15-11(10)17-2/h4,6,8H,5,7H2,1-3H3,(H,13,16) |
| InChIKey | TZGNUJZYXQQOFD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|