C14H19NO3 — CID 170488942
N-[4-(2,5-dimethoxyphenyl)but-3-enyl]acetamide (PubChem CID 170488942) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)but-3-enyl]acetamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170488942 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)but-3-enyl]acetamide |
| SMILES | COc1ccc(OC)c(C=CCCNC(C)=O)c1 |
| InChI | InChI=1S/C14H19NO3/c1-11(16)15-9-5-4-6-12-10-13(17-2)7-8-14(12)18-3/h4,6-8,10H,5,9H2,1-3H3,(H,15,16) |
| InChIKey | VDGYGTANXMLIAE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|