C15H19NO3 — CID 98017113
N-[4-methoxy-3-[(E)-5-oxohex-1-enyl]phenyl]acetamide (PubChem CID 98017113) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[4-methoxy-3-[(E)-5-oxohex-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-methoxy-3-[(E)-5-oxohex-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 98017113 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-[4-methoxy-3-[(E)-5-oxohex-1-enyl]phenyl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1/C=C/CCC(C)=O |
| InChI | InChI=1S/C15H19NO3/c1-11(17)6-4-5-7-13-10-14(16-12(2)18)8-9-15(13)19-3/h5,7-10H,4,6H2,1-3H3,(H,16,18)/b7-5+ |
| InChIKey | LKJFVBTUAXYTRG-FNORWQNLSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |