C12H12NO4- — CID 7452463
(E)-3-(5-acetamido-2-methoxyphenyl)prop-2-enoate (PubChem CID 7452463) has the molecular formula C12H12NO4- and a molecular weight of 234.23 g/mol. Its IUPAC name is (E)-3-(5-acetamido-2-methoxyphenyl)prop-2-enoate.
| Compound Name | (E)-3-(5-acetamido-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7452463 |
| Molecular Formula | C12H12NO4- |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (E)-3-(5-acetamido-2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(NC(C)=O)cc1/C=C/C(=O)[O-] |
| InChI | InChI=1S/C12H13NO4/c1-8(14)13-10-4-5-11(17-2)9(7-10)3-6-12(15)16/h3-7H,1-2H3,(H,13,14)(H,15,16)/p-1/b6-3+ |
| InChIKey | QIBUXMXHBORPAK-ZZXKWVIFSA-M |
| XLogP | 0.42 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|