C11H17N3O2 — CID 23589029
(E)-5-(2,4-dimethoxypyrimidin-5-yl)pent-4-en-2-amine (PubChem CID 23589029) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is (E)-5-(2,4-dimethoxypyrimidin-5-yl)pent-4-en-2-amine.
| Compound Name | (E)-5-(2,4-dimethoxypyrimidin-5-yl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 23589029 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | (E)-5-(2,4-dimethoxypyrimidin-5-yl)pent-4-en-2-amine |
| SMILES | COc1ncc(/C=C/CC(C)N)c(OC)n1 |
| InChI | InChI=1S/C11H17N3O2/c1-8(12)5-4-6-9-7-13-11(16-3)14-10(9)15-2/h4,6-8H,5,12H2,1-3H3/b6-4+ |
| InChIKey | ROBRKTIORFNBQH-GQCTYLIASA-N |
| XLogP | 1.24 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |