C9H13N3O4 — CID 82662650
2-amino-3-(2,4-dimethoxypyrimidin-5-yl)propanoic acid (PubChem CID 82662650) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-amino-3-(2,4-dimethoxypyrimidin-5-yl)propanoic acid.
| Compound Name | 2-amino-3-(2,4-dimethoxypyrimidin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 82662650 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-amino-3-(2,4-dimethoxypyrimidin-5-yl)propanoic acid |
| SMILES | COc1ncc(CC(N)C(=O)O)c(OC)n1 |
| InChI | InChI=1S/C9H13N3O4/c1-15-7-5(3-6(10)8(13)14)4-11-9(12-7)16-2/h4,6H,3,10H2,1-2H3,(H,13,14) |
| InChIKey | JYTTUNITGWYPBZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |