4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid

C10H14N2O4 — CID 105483714

IUPAC4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid
SMILESCOc1ncc(CCCC(=O)O)c(OC)n1
InChIInChI=1S/C10H14N2O4/c1-15-9-7(4-3-5-8(13)14)6-11-10(12-9)16-2/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeyVRADDMGGKOIFSV-UHFFFAOYSA-N
MW226.23 g/mol
LogP0.90
Rot. Bonds6

About 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid

4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid (PubChem CID 105483714) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid.

Molecular Properties

Compound Name4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid
PubChem CID105483714
Molecular FormulaC10H14N2O4
Molecular Weight226.23 g/mol
Exact Mass226.10
IUPAC Name4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid
SMILESCOc1ncc(CCCC(=O)O)c(OC)n1
InChIInChI=1S/C10H14N2O4/c1-15-9-7(4-3-5-8(13)14)6-11-10(12-9)16-2/h6H,3-5H2,1-2H3,(H,13,14)
InChIKeyVRADDMGGKOIFSV-UHFFFAOYSA-N
XLogP0.90
TPSA81.54 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.23
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid?
The IUPAC name of 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid (CID 105483714) is 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid.
What is the SMILES notation for 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid?
The canonical SMILES for 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid is COc1ncc(CCCC(=O)O)c(OC)n1.
What is the InChIKey of 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid?
The InChIKey is VRADDMGGKOIFSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O4/c1-15-9-7(4-3-5-8(13)14)6-11-10(12-9)16-2/h6H,3-5H2,1-2H3,(H,13,14).
What are the key properties of 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid?
4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid has a molecular weight of 226.23 g/mol, XLogP of 0.90, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethoxypyrimidin-5-yl)butanoic acid is sourced from PubChem (CID 105483714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).