C17H18N6O3 — CID 91227637
4-amino-8-[2-(2,4-dimethoxypyrimidin-5-yl)ethyl]cinnoline-3-carboxamide (PubChem CID 91227637) has the molecular formula C17H18N6O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-amino-8-[2-(2,4-dimethoxypyrimidin-5-yl)ethyl]cinnoline-3-carboxamide.
| Compound Name | 4-amino-8-[2-(2,4-dimethoxypyrimidin-5-yl)ethyl]cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 91227637 |
| Molecular Formula | C17H18N6O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-amino-8-[2-(2,4-dimethoxypyrimidin-5-yl)ethyl]cinnoline-3-carboxamide |
| SMILES | COc1ncc(CCc2cccc3c(N)c(C(N)=O)nnc23)c(OC)n1 |
| InChI | InChI=1S/C17H18N6O3/c1-25-16-10(8-20-17(21-16)26-2)7-6-9-4-3-5-11-12(18)14(15(19)24)23-22-13(9)11/h3-5,8H,6-7H2,1-2H3,(H2,18,22)(H2,19,24) |
| InChIKey | IUJMJSOGJMBIPF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 139.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |