C19H20N6O3 — CID 59791549
4-amino-N-cyclobutyl-8-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide (PubChem CID 59791549) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-amino-N-cyclobutyl-8-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide.
| Compound Name | 4-amino-N-cyclobutyl-8-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 59791549 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-amino-N-cyclobutyl-8-(2,4-dimethoxypyrimidin-5-yl)cinnoline-3-carboxamide |
| SMILES | COc1ncc(-c2cccc3c(N)c(C(=O)NC4CCC4)nnc23)c(OC)n1 |
| InChI | InChI=1S/C19H20N6O3/c1-27-18-13(9-21-19(23-18)28-2)11-7-4-8-12-14(20)16(25-24-15(11)12)17(26)22-10-5-3-6-10/h4,7-10H,3,5-6H2,1-2H3,(H2,20,24)(H,22,26) |
| InChIKey | KGMWMMKYZGKDFE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 125.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |