C22H24N4O4 — CID 25183553
4-amino-N-cyclobutyl-8-(2,3,4-trimethoxyphenyl)cinnoline-3-carboxamide (PubChem CID 25183553) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-amino-N-cyclobutyl-8-(2,3,4-trimethoxyphenyl)cinnoline-3-carboxamide.
| Compound Name | 4-amino-N-cyclobutyl-8-(2,3,4-trimethoxyphenyl)cinnoline-3-carboxamide |
|---|---|
| PubChem CID | 25183553 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 4-amino-N-cyclobutyl-8-(2,3,4-trimethoxyphenyl)cinnoline-3-carboxamide |
| SMILES | COc1ccc(-c2cccc3c(N)c(C(=O)NC4CCC4)nnc23)c(OC)c1OC |
| InChI | InChI=1S/C22H24N4O4/c1-28-16-11-10-14(20(29-2)21(16)30-3)13-8-5-9-15-17(23)19(26-25-18(13)15)22(27)24-12-6-4-7-12/h5,8-12H,4,6-7H2,1-3H3,(H2,23,25)(H,24,27) |
| InChIKey | GPCDJZRFYYEABZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |