C21H21FN4O3 — CID 59791565
4-amino-N-cyclobutyl-8-(2,3-dimethoxyphenyl)-7-fluorocinnoline-3-carboxamide (PubChem CID 59791565) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 4-amino-N-cyclobutyl-8-(2,3-dimethoxyphenyl)-7-fluorocinnoline-3-carboxamide.
| Compound Name | 4-amino-N-cyclobutyl-8-(2,3-dimethoxyphenyl)-7-fluorocinnoline-3-carboxamide |
|---|---|
| PubChem CID | 59791565 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-amino-N-cyclobutyl-8-(2,3-dimethoxyphenyl)-7-fluorocinnoline-3-carboxamide |
| SMILES | COc1cccc(-c2c(F)ccc3c(N)c(C(=O)NC4CCC4)nnc23)c1OC |
| InChI | InChI=1S/C21H21FN4O3/c1-28-15-8-4-7-12(20(15)29-2)16-14(22)10-9-13-17(23)19(26-25-18(13)16)21(27)24-11-5-3-6-11/h4,7-11H,3,5-6H2,1-2H3,(H2,23,25)(H,24,27) |
| InChIKey | UQWVZWRKNGBQJU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |