C11H14N2O3 — CID 21088893
N-cyclobutyl-3-hydroxy-4-methoxypyridine-2-carboxamide (PubChem CID 21088893) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N-cyclobutyl-3-hydroxy-4-methoxypyridine-2-carboxamide.
| Compound Name | N-cyclobutyl-3-hydroxy-4-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 21088893 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-cyclobutyl-3-hydroxy-4-methoxypyridine-2-carboxamide |
| SMILES | COc1ccnc(C(=O)NC2CCC2)c1O |
| InChI | InChI=1S/C11H14N2O3/c1-16-8-5-6-12-9(10(8)14)11(15)13-7-3-2-4-7/h5-7,14H,2-4H2,1H3,(H,13,15) |
| InChIKey | USQXMHQJTQRQKL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |