C9H10N2O4 — CID 688431
3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoic acid (PubChem CID 688431) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoic acid.
| Compound Name | 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 688431 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-(2,4-dimethoxypyrimidin-5-yl)prop-2-enoic acid |
| SMILES | COc1ncc(C=CC(=O)O)c(OC)n1 |
| InChI | InChI=1S/C9H10N2O4/c1-14-8-6(3-4-7(12)13)5-10-9(11-8)15-2/h3-5H,1-2H3,(H,12,13) |
| InChIKey | MJGYRIKINWQSPO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|