C17H15N3O6S — CID 58843137
(Z)-3-[2-methoxy-7-(4-methoxyphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoic acid (PubChem CID 58843137) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is (Z)-3-[2-methoxy-7-(4-methoxyphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (Z)-3-[2-methoxy-7-(4-methoxyphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58843137 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | (Z)-3-[2-methoxy-7-(4-methoxyphenyl)sulfonylpyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enoic acid |
| SMILES | COc1ccc(S(=O)(=O)n2cc(/C=C\C(=O)O)c3cnc(OC)nc32)cc1 |
| InChI | InChI=1S/C17H15N3O6S/c1-25-12-4-6-13(7-5-12)27(23,24)20-10-11(3-8-15(21)22)14-9-18-17(26-2)19-16(14)20/h3-10H,1-2H3,(H,21,22)/b8-3- |
| InChIKey | GMRLKJHUVNUGHS-BAQGIRSFSA-N |
| XLogP | 1.78 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|