C18H13Cl2NO5S — CID 18450061
(E)-3-[1-(3,4-dichlorophenyl)sulfonyl-5-methoxyindol-3-yl]prop-2-enoic acid (PubChem CID 18450061) has the molecular formula C18H13Cl2NO5S and a molecular weight of 426.28 g/mol. Its IUPAC name is (E)-3-[1-(3,4-dichlorophenyl)sulfonyl-5-methoxyindol-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1-(3,4-dichlorophenyl)sulfonyl-5-methoxyindol-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 18450061 |
| Molecular Formula | C18H13Cl2NO5S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | (E)-3-[1-(3,4-dichlorophenyl)sulfonyl-5-methoxyindol-3-yl]prop-2-enoic acid |
| SMILES | COc1ccc2c(c1)c(/C=C/C(=O)O)cn2S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2NO5S/c1-26-12-3-6-17-14(8-12)11(2-7-18(22)23)10-21(17)27(24,25)13-4-5-15(19)16(20)9-13/h2-10H,1H3,(H,22,23)/b7-2+ |
| InChIKey | JPRLBJBPHBPBNK-FARCUNLSSA-N |
| XLogP | 4.29 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|