C18H16N2O6S — CID 123874793
3-[1-(3,4-dimethoxyphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid (PubChem CID 123874793) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 3-[1-(3,4-dimethoxyphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid.
| Compound Name | 3-[1-(3,4-dimethoxyphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123874793 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 3-[1-(3,4-dimethoxyphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid |
| SMILES | COc1ccc(S(=O)(=O)n2ccc3cc(C=CC(=O)O)cnc32)cc1OC |
| InChI | InChI=1S/C18H16N2O6S/c1-25-15-5-4-14(10-16(15)26-2)27(23,24)20-8-7-13-9-12(3-6-17(21)22)11-19-18(13)20/h3-11H,1-2H3,(H,21,22) |
| InChIKey | UQZUMKHDKSDCMN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|