C19H18N2O6S — CID 67563232
amino (E)-3-[1-(3,4-dimethoxyphenyl)sulfonylindol-5-yl]prop-2-enoate (PubChem CID 67563232) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is amino (E)-3-[1-(3,4-dimethoxyphenyl)sulfonylindol-5-yl]prop-2-enoate.
| Compound Name | amino (E)-3-[1-(3,4-dimethoxyphenyl)sulfonylindol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67563232 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | amino (E)-3-[1-(3,4-dimethoxyphenyl)sulfonylindol-5-yl]prop-2-enoate |
| SMILES | COc1ccc(S(=O)(=O)n2ccc3cc(/C=C/C(=O)ON)ccc32)cc1OC |
| InChI | InChI=1S/C19H18N2O6S/c1-25-17-7-5-15(12-18(17)26-2)28(23,24)21-10-9-14-11-13(3-6-16(14)21)4-8-19(22)27-20/h3-12H,20H2,1-2H3/b8-4+ |
| InChIKey | LHMHEIKMHSVLOO-XBXARRHUSA-N |
| XLogP | 2.33 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|