C17H13FN2O4S — CID 67561854
amino (E)-3-[1-(4-fluorophenyl)sulfonylindol-5-yl]prop-2-enoate (PubChem CID 67561854) has the molecular formula C17H13FN2O4S and a molecular weight of 360.37 g/mol. Its IUPAC name is amino (E)-3-[1-(4-fluorophenyl)sulfonylindol-5-yl]prop-2-enoate.
| Compound Name | amino (E)-3-[1-(4-fluorophenyl)sulfonylindol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67561854 |
| Molecular Formula | C17H13FN2O4S |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | amino (E)-3-[1-(4-fluorophenyl)sulfonylindol-5-yl]prop-2-enoate |
| SMILES | NOC(=O)/C=C/c1ccc2c(ccn2S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H13FN2O4S/c18-14-3-5-15(6-4-14)25(22,23)20-10-9-13-11-12(1-7-16(13)20)2-8-17(21)24-19/h1-11H,19H2/b8-2+ |
| InChIKey | ZYIQONBFLZDWGF-KRXBUXKQSA-N |
| XLogP | 2.45 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|