C30H22FNO4S — CID 67337489
4-(4-fluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylindol-6-yl]ethenyl]benzoic acid (PubChem CID 67337489) has the molecular formula C30H22FNO4S and a molecular weight of 511.57 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylindol-6-yl]ethenyl]benzoic acid.
| Compound Name | 4-(4-fluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylindol-6-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 67337489 |
| Molecular Formula | C30H22FNO4S |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 4-(4-fluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylindol-6-yl]ethenyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3ccc(C=Cc4cc(-c5ccc(F)cc5)ccc4C(=O)O)cc32)cc1 |
| InChI | InChI=1S/C30H22FNO4S/c1-20-2-13-27(14-3-20)37(35,36)32-17-16-23-6-4-21(18-29(23)32)5-7-25-19-24(10-15-28(25)30(33)34)22-8-11-26(31)12-9-22/h2-19H,1H3,(H,33,34) |
| InChIKey | LABDNMXOTMKWRR-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|