C28H27NO6S — CID 139703317
2-methyl-3-[1-(4-methylphenyl)sulfonylindol-6-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 139703317) has the molecular formula C28H27NO6S and a molecular weight of 505.59 g/mol. Its IUPAC name is 2-methyl-3-[1-(4-methylphenyl)sulfonylindol-6-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 2-methyl-3-[1-(4-methylphenyl)sulfonylindol-6-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139703317 |
| Molecular Formula | C28H27NO6S |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | 2-methyl-3-[1-(4-methylphenyl)sulfonylindol-6-yl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C(=O)C(C)=Cc2ccc3ccn(S(=O)(=O)c4ccc(C)cc4)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C28H27NO6S/c1-18-6-10-23(11-7-18)36(31,32)29-13-12-21-9-8-20(15-24(21)29)14-19(2)27(30)22-16-25(33-3)28(35-5)26(17-22)34-4/h6-17H,1-5H3 |
| InChIKey | VABBNPYLRSJTRG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|