C16H11FN2O4S — CID 123264890
3-[1-(4-fluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid (PubChem CID 123264890) has the molecular formula C16H11FN2O4S and a molecular weight of 346.34 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid.
| Compound Name | 3-[1-(4-fluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123264890 |
| Molecular Formula | C16H11FN2O4S |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-[1-(4-fluorophenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cnc2c(ccn2S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H11FN2O4S/c17-13-2-4-14(5-3-13)24(22,23)19-8-7-12-9-11(1-6-15(20)21)10-18-16(12)19/h1-10H,(H,20,21) |
| InChIKey | UYQVNJRUCJYTAF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|