C20H18O6S — CID 58903040
(E)-3-[6-methoxy-3-(4-methoxyphenyl)sulfonyl-3H-inden-1-yl]prop-2-enoic acid (PubChem CID 58903040) has the molecular formula C20H18O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is (E)-3-[6-methoxy-3-(4-methoxyphenyl)sulfonyl-3H-inden-1-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-methoxy-3-(4-methoxyphenyl)sulfonyl-3H-inden-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58903040 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (E)-3-[6-methoxy-3-(4-methoxyphenyl)sulfonyl-3H-inden-1-yl]prop-2-enoic acid |
| SMILES | COc1ccc(S(=O)(=O)C2C=C(/C=C/C(=O)O)c3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C20H18O6S/c1-25-14-4-7-16(8-5-14)27(23,24)19-11-13(3-10-20(21)22)18-12-15(26-2)6-9-17(18)19/h3-12,19H,1-2H3,(H,21,22)/b10-3+ |
| InChIKey | IMXCCRSIFWOBRN-XCVCLJGOSA-N |
| XLogP | 3.26 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|