C7H10N4O3 — CID 83831468
2-amino-3-(3-methoxy-1,2,4-triazin-6-yl)propanoic acid (PubChem CID 83831468) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 2-amino-3-(3-methoxy-1,2,4-triazin-6-yl)propanoic acid.
| Compound Name | 2-amino-3-(3-methoxy-1,2,4-triazin-6-yl)propanoic acid |
|---|---|
| PubChem CID | 83831468 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-amino-3-(3-methoxy-1,2,4-triazin-6-yl)propanoic acid |
| SMILES | COc1ncc(CC(N)C(=O)O)nn1 |
| InChI | InChI=1S/C7H10N4O3/c1-14-7-9-3-4(10-11-7)2-5(8)6(12)13/h3,5H,2,8H2,1H3,(H,12,13) |
| InChIKey | JPMBMXSGOXEBDZ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 111.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |