C9H11BrN2O2 — CID 131053081
(2S)-2-amino-3-(5-bromo-4-methyl-2-pyridinyl)propanoic acid (PubChem CID 131053081) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is (2S)-2-amino-3-(5-bromo-4-methyl-2-pyridinyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(5-bromo-4-methyl-2-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 131053081 |
| Molecular Formula | C9H11BrN2O2 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (2S)-2-amino-3-(5-bromo-4-methyl-2-pyridinyl)propanoic acid |
| SMILES | Cc1cc(C[C@H](N)C(=O)O)ncc1Br |
| InChI | InChI=1S/C9H11BrN2O2/c1-5-2-6(12-4-7(5)10)3-8(11)9(13)14/h2,4,8H,3,11H2,1H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | GYBNBHLEVZAAJX-QMMMGPOBSA-N |
| XLogP | 1.11 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |