C9H13BN2O4 — CID 174030715
2-amino-3-(5-borono-4-methyl-2-pyridinyl)propanoic acid (PubChem CID 174030715) has the molecular formula C9H13BN2O4 and a molecular weight of 224.03 g/mol. Its IUPAC name is 2-amino-3-(5-borono-4-methyl-2-pyridinyl)propanoic acid.
| Compound Name | 2-amino-3-(5-borono-4-methyl-2-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 174030715 |
| Molecular Formula | C9H13BN2O4 |
| Molecular Weight | 224.03 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-amino-3-(5-borono-4-methyl-2-pyridinyl)propanoic acid |
| SMILES | Cc1cc(CC(N)C(=O)O)ncc1B(O)O |
| InChI | InChI=1S/C9H13BN2O4/c1-5-2-6(3-8(11)9(13)14)12-4-7(5)10(15)16/h2,4,8,15-16H,3,11H2,1H3,(H,13,14) |
| InChIKey | WTHZOULTMYKBQE-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.03 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|